C10H12F6O9S2 — CID 56649707
[(3aR,5R,6R,6aR)-2,2-dimethyl-6-(trifluoromethylsulfonyloxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl trifluoromethanesulfonate (PubChem CID 56649707) has the molecular formula C10H12F6O9S2 and a molecular weight of 454.32 g/mol. Its IUPAC name is [(3aR,5R,6R,6aR)-2,2-dimethyl-6-(trifluoromethylsulfonyloxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl trifluoromethanesulfonate.
| Compound Name | [(3aR,5R,6R,6aR)-2,2-dimethyl-6-(trifluoromethylsulfonyloxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 56649707 |
| Molecular Formula | C10H12F6O9S2 |
| Molecular Weight | 454.32 g/mol |
| Exact Mass | 453.98 |
| IUPAC Name | [(3aR,5R,6R,6aR)-2,2-dimethyl-6-(trifluoromethylsulfonyloxy)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl trifluoromethanesulfonate |
| SMILES | CC1(C)O[C@H]2O[C@H](COS(=O)(=O)C(F)(F)F)[C@@H](OS(=O)(=O)C(F)(F)F)[C@H]2O1 |
| InChI | InChI=1S/C10H12F6O9S2/c1-8(2)23-6-5(25-27(19,20)10(14,15)16)4(22-7(6)24-8)3-21-26(17,18)9(11,12)13/h4-7H,3H2,1-2H3/t4-,5-,6-,7-/m1/s1 |
| InChIKey | UKSLJPCNRILSRN-DBRKOABJSA-N |
| XLogP | 0.96 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|