C9H13F3O6S — CID 91148888
[(3aR,5R,6aS)-5-(dideuteriomethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] trifluoromethanesulfonate (PubChem CID 91148888) has the molecular formula C9H13F3O6S and a molecular weight of 308.27 g/mol. Its IUPAC name is [(3aR,5R,6aS)-5-(dideuteriomethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] trifluoromethanesulfonate.
| Compound Name | [(3aR,5R,6aS)-5-(dideuteriomethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 91148888 |
| Molecular Formula | C9H13F3O6S |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | [(3aR,5R,6aS)-5-(dideuteriomethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl] trifluoromethanesulfonate |
| SMILES | [2H]C([2H])[C@H]1O[C@@H]2OC(C)(C)O[C@H]2C1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C9H13F3O6S/c1-4-5(18-19(13,14)9(10,11)12)6-7(15-4)17-8(2,3)16-6/h4-7H,1-3H3/t4-,5?,6+,7-/m1/s1/i1D2 |
| InChIKey | ZPGCYCZGCKOLDS-VHHANSGLSA-N |
| XLogP | 1.12 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|