C11H16F3N3O7S — CID 101220624
[(1R)-1-[(3aR,5S,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-azidoethyl] trifluoromethanesulfonate (PubChem CID 101220624) has the molecular formula C11H16F3N3O7S and a molecular weight of 391.32 g/mol. Its IUPAC name is [(1R)-1-[(3aR,5S,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-azidoethyl] trifluoromethanesulfonate.
| Compound Name | [(1R)-1-[(3aR,5S,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-azidoethyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 101220624 |
| Molecular Formula | C11H16F3N3O7S |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | [(1R)-1-[(3aR,5S,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-azidoethyl] trifluoromethanesulfonate |
| SMILES | CO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@@H](CN=[N+]=[N-])OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H16F3N3O7S/c1-10(2)22-8-7(20-3)6(21-9(8)23-10)5(4-16-17-15)24-25(18,19)11(12,13)14/h5-9H,4H2,1-3H3/t5-,6-,7+,8-,9-/m1/s1 |
| InChIKey | MSSGPNQECQTKNB-SYHAXYEDSA-N |
| XLogP | 1.42 |
| TPSA | 129.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|