C16H29N3O7Si — CID 11373064
(2S,3S)-3-[(3aR,5R,6R,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-azido-3-hydroxypropanoic acid (PubChem CID 11373064) has the molecular formula C16H29N3O7Si and a molecular weight of 403.51 g/mol. Its IUPAC name is (2S,3S)-3-[(3aR,5R,6R,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-azido-3-hydroxypropanoic acid.
| Compound Name | (2S,3S)-3-[(3aR,5R,6R,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-azido-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 11373064 |
| Molecular Formula | C16H29N3O7Si |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | (2S,3S)-3-[(3aR,5R,6R,6aR)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-azido-3-hydroxypropanoic acid |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@@H](O)[C@H](N=[N+]=[N-])C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C16H29N3O7Si/c1-15(2,3)27(6,7)26-11-10(9(20)8(13(21)22)18-19-17)23-14-12(11)24-16(4,5)25-14/h8-12,14,20H,1-7H3,(H,21,22)/t8-,9-,10+,11+,12+,14+/m0/s1 |
| InChIKey | IPZATFGLTPJDLQ-IPKGDQBGSA-N |
| XLogP | 2.38 |
| TPSA | 143.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|