C10H13F3O7S — CID 11209822
[(3aR,4S,7S,7aR)-2,2,4-trimethyl-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] trifluoromethanesulfonate (PubChem CID 11209822) has the molecular formula C10H13F3O7S and a molecular weight of 334.27 g/mol. Its IUPAC name is [(3aR,4S,7S,7aR)-2,2,4-trimethyl-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] trifluoromethanesulfonate.
| Compound Name | [(3aR,4S,7S,7aR)-2,2,4-trimethyl-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11209822 |
| Molecular Formula | C10H13F3O7S |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | [(3aR,4S,7S,7aR)-2,2,4-trimethyl-6-oxo-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] trifluoromethanesulfonate |
| SMILES | C[C@@H]1OC(=O)[C@@H](OS(=O)(=O)C(F)(F)F)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C10H13F3O7S/c1-4-5-6(19-9(2,3)18-5)7(8(14)17-4)20-21(15,16)10(11,12)13/h4-7H,1-3H3/t4-,5+,6+,7-/m0/s1 |
| InChIKey | YTGPJFFDXAPGGZ-WNJXEPBRSA-N |
| XLogP | 0.69 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|