C14H23F3O9S — CID 101086702
[(2S,3S,4aR,5R,7S,8S,8aS)-2,3,7-trimethoxy-2,3,5-trimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl] trifluoromethanesulfonate (PubChem CID 101086702) has the molecular formula C14H23F3O9S and a molecular weight of 424.39 g/mol. Its IUPAC name is [(2S,3S,4aR,5R,7S,8S,8aS)-2,3,7-trimethoxy-2,3,5-trimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl] trifluoromethanesulfonate.
| Compound Name | [(2S,3S,4aR,5R,7S,8S,8aS)-2,3,7-trimethoxy-2,3,5-trimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 101086702 |
| Molecular Formula | C14H23F3O9S |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | [(2S,3S,4aR,5R,7S,8S,8aS)-2,3,7-trimethoxy-2,3,5-trimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl] trifluoromethanesulfonate |
| SMILES | CO[C@H]1O[C@H](C)[C@H]2O[C@](C)(OC)[C@@](C)(OC)O[C@@H]2[C@@H]1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H23F3O9S/c1-7-8-9(25-13(3,22-6)12(2,21-5)24-8)10(11(20-4)23-7)26-27(18,19)14(15,16)17/h7-11H,1-6H3/t7-,8-,9+,10+,11+,12+,13+/m1/s1 |
| InChIKey | PQVFPDAJNPNVCV-GSAQDRDJSA-N |
| XLogP | 1.12 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|