C19H31F3O12S — CID 11827654
[(1S,3R,5R,6R,8S,10R,12S,13S)-9-hydroxy-5,6,12,13-tetramethoxy-5,6,12,13-tetramethyl-4,7,11,14-tetraoxatricyclo[8.4.0.03,8]tetradecan-2-yl] trifluoromethanesulfonate (PubChem CID 11827654) has the molecular formula C19H31F3O12S and a molecular weight of 540.51 g/mol. Its IUPAC name is [(1S,3R,5R,6R,8S,10R,12S,13S)-9-hydroxy-5,6,12,13-tetramethoxy-5,6,12,13-tetramethyl-4,7,11,14-tetraoxatricyclo[8.4.0.03,8]tetradecan-2-yl] trifluoromethanesulfonate.
| Compound Name | [(1S,3R,5R,6R,8S,10R,12S,13S)-9-hydroxy-5,6,12,13-tetramethoxy-5,6,12,13-tetramethyl-4,7,11,14-tetraoxatricyclo[8.4.0.03,8]tetradecan-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11827654 |
| Molecular Formula | C19H31F3O12S |
| Molecular Weight | 540.51 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | [(1S,3R,5R,6R,8S,10R,12S,13S)-9-hydroxy-5,6,12,13-tetramethoxy-5,6,12,13-tetramethyl-4,7,11,14-tetraoxatricyclo[8.4.0.03,8]tetradecan-2-yl] trifluoromethanesulfonate |
| SMILES | CO[C@@]1(C)O[C@@H]2C(O)[C@@H]3O[C@@](C)(OC)[C@](C)(OC)O[C@H]3C(OS(=O)(=O)C(F)(F)F)[C@H]2O[C@]1(C)OC |
| InChI | InChI=1S/C19H31F3O12S/c1-15(26-5)17(3,28-7)32-12-10(30-15)9(23)11-13(14(12)34-35(24,25)19(20,21)22)33-18(4,29-8)16(2,27-6)31-11/h9-14,23H,1-8H3/t9?,10-,11+,12+,13-,14?,15+,16-,17+,18- |
| InChIKey | CHIDITIBCNNXSP-WCGBSUSESA-N |
| XLogP | 0.61 |
| TPSA | 137.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.51 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|