C25H36O11 — CID 156587407
[(1S,8S)-9-hydroxy-5,6,12,13-tetramethoxy-5,6,12,13-tetramethyl-4,7,11,14-tetraoxatricyclo[8.4.0.03,8]tetradecan-2-yl] benzoate (PubChem CID 156587407) has the molecular formula C25H36O11 and a molecular weight of 512.55 g/mol. Its IUPAC name is [(1S,8S)-9-hydroxy-5,6,12,13-tetramethoxy-5,6,12,13-tetramethyl-4,7,11,14-tetraoxatricyclo[8.4.0.03,8]tetradecan-2-yl] benzoate.
| Compound Name | [(1S,8S)-9-hydroxy-5,6,12,13-tetramethoxy-5,6,12,13-tetramethyl-4,7,11,14-tetraoxatricyclo[8.4.0.03,8]tetradecan-2-yl] benzoate |
|---|---|
| PubChem CID | 156587407 |
| Molecular Formula | C25H36O11 |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | [(1S,8S)-9-hydroxy-5,6,12,13-tetramethoxy-5,6,12,13-tetramethyl-4,7,11,14-tetraoxatricyclo[8.4.0.03,8]tetradecan-2-yl] benzoate |
| SMILES | COC1(C)OC2C(O)[C@@H]3OC(C)(OC)C(C)(OC)OC3C(OC(=O)c3ccccc3)[C@H]2OC1(C)OC |
| InChI | InChI=1S/C25H36O11/c1-22(28-5)24(3,30-7)35-19-16(33-22)15(26)17-20(36-25(4,31-8)23(2,29-6)34-17)18(19)32-21(27)14-12-10-9-11-13-14/h9-13,15-20,26H,1-8H3/t15?,16-,17?,18?,19?,20-,22?,23?,24?,25?/m0/s1 |
| InChIKey | OQOUCOFWGOADIO-SKVBPHLOSA-N |
| XLogP | 1.60 |
| TPSA | 120.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |