C12H22O8 — CID 90902374
(2R,3R,4aR,5R,7R,8R,8aS)-7-(hydroxymethyl)-2,3-dimethoxy-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxine-5,8-diol (PubChem CID 90902374) has the molecular formula C12H22O8 and a molecular weight of 294.30 g/mol. Its IUPAC name is (2R,3R,4aR,5R,7R,8R,8aS)-7-(hydroxymethyl)-2,3-dimethoxy-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxine-5,8-diol.
| Compound Name | (2R,3R,4aR,5R,7R,8R,8aS)-7-(hydroxymethyl)-2,3-dimethoxy-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxine-5,8-diol |
|---|---|
| PubChem CID | 90902374 |
| Molecular Formula | C12H22O8 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (2R,3R,4aR,5R,7R,8R,8aS)-7-(hydroxymethyl)-2,3-dimethoxy-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxine-5,8-diol |
| SMILES | CO[C@]1(C)O[C@@H]2[C@@H](O[C@@]1(C)OC)[C@H](O)[C@@H](CO)O[C@H]2O |
| InChI | InChI=1S/C12H22O8/c1-11(16-3)12(2,17-4)20-9-8(19-11)7(14)6(5-13)18-10(9)15/h6-10,13-15H,5H2,1-4H3/t6-,7-,8+,9-,10-,11-,12-/m1/s1 |
| InChIKey | JTZIKYNREGAHSS-HTWMRFIXSA-N |
| XLogP | -1.43 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |