C26H46N6O12 — CID 139065148
(2R,3R,4aS,5S,7R,8S,8aS)-8-azido-2,3,7-trimethoxy-2,3,5-trimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxine (PubChem CID 139065148) has the molecular formula C26H46N6O12 and a molecular weight of 634.68 g/mol. Its IUPAC name is (2R,3R,4aS,5S,7R,8S,8aS)-8-azido-2,3,7-trimethoxy-2,3,5-trimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxine.
| Compound Name | (2R,3R,4aS,5S,7R,8S,8aS)-8-azido-2,3,7-trimethoxy-2,3,5-trimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 139065148 |
| Molecular Formula | C26H46N6O12 |
| Molecular Weight | 634.68 g/mol |
| Exact Mass | 634.32 |
| IUPAC Name | (2R,3R,4aS,5S,7R,8S,8aS)-8-azido-2,3,7-trimethoxy-2,3,5-trimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxine |
| SMILES | CO[C@@H]1O[C@@H](C)[C@@H]2O[C@@](C)(OC)[C@](C)(OC)O[C@H]2[C@@H]1N=[N+]=[N-].CO[C@@H]1O[C@@H](C)[C@@H]2O[C@@](C)(OC)[C@](C)(OC)O[C@H]2[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/2C13H23N3O6/c2*1-7-9-10(8(15-16-14)11(17-4)20-7)22-13(3,19-6)12(2,18-5)21-9/h2*7-11H,1-6H3/t2*7-,8-,9-,10-,11+,12+,13+/m00/s1 |
| InChIKey | CDLCPHFLTYFTLE-XNCYGCHTSA-N |
| XLogP | 3.13 |
| TPSA | 208.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.68 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|