C20H27N3O6S2 — CID 53304578
S-[[(2S,3S,4aS,5S,7S,8R,8aR)-8-azido-2,3-dimethoxy-2,3-dimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-5-yl]methyl] ethanethioate (PubChem CID 53304578) has the molecular formula C20H27N3O6S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is S-[[(2S,3S,4aS,5S,7S,8R,8aR)-8-azido-2,3-dimethoxy-2,3-dimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-5-yl]methyl] ethanethioate.
| Compound Name | S-[[(2S,3S,4aS,5S,7S,8R,8aR)-8-azido-2,3-dimethoxy-2,3-dimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-5-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 53304578 |
| Molecular Formula | C20H27N3O6S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | S-[[(2S,3S,4aS,5S,7S,8R,8aR)-8-azido-2,3-dimethoxy-2,3-dimethyl-7-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-5-yl]methyl] ethanethioate |
| SMILES | CO[C@@]1(C)O[C@@H]2[C@@H](N=[N+]=[N-])[C@H](Sc3ccccc3)O[C@H](CSC(C)=O)[C@H]2O[C@]1(C)OC |
| InChI | InChI=1S/C20H27N3O6S2/c1-12(24)30-11-14-16-17(29-20(3,26-5)19(2,25-4)28-16)15(22-23-21)18(27-14)31-13-9-7-6-8-10-13/h6-10,14-18H,11H2,1-5H3/t14-,15-,16-,17-,18+,19+,20+/m1/s1 |
| InChIKey | KRDVHMRZHRITKW-PHJNVHRLSA-N |
| XLogP | 3.97 |
| TPSA | 111.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|