C18H24N6O5S — CID 101385428
(4aR,5R,8R,8aS)-7-azido-5-(azidomethyl)-2,3-dimethoxy-2,3-dimethyl-8-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxine (PubChem CID 101385428) has the molecular formula C18H24N6O5S and a molecular weight of 436.49 g/mol. Its IUPAC name is (4aR,5R,8R,8aS)-7-azido-5-(azidomethyl)-2,3-dimethoxy-2,3-dimethyl-8-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxine.
| Compound Name | (4aR,5R,8R,8aS)-7-azido-5-(azidomethyl)-2,3-dimethoxy-2,3-dimethyl-8-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 101385428 |
| Molecular Formula | C18H24N6O5S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | (4aR,5R,8R,8aS)-7-azido-5-(azidomethyl)-2,3-dimethoxy-2,3-dimethyl-8-phenylsulfanyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxine |
| SMILES | COC1(C)O[C@H]2[C@H](OC1(C)OC)[C@@H](Sc1ccccc1)C(N=[N+]=[N-])O[C@@H]2CN=[N+]=[N-] |
| InChI | InChI=1S/C18H24N6O5S/c1-17(25-3)18(2,26-4)29-14-13(28-17)12(10-21-23-19)27-16(22-24-20)15(14)30-11-8-6-5-7-9-11/h5-9,12-16H,10H2,1-4H3/t12-,13-,14+,15-,16?,17?,18?/m1/s1 |
| InChIKey | FDQUVKZANVRXBR-LDXWETMUSA-N |
| XLogP | 4.00 |
| TPSA | 143.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|