C22H26N3O7P — CID 71530003
[(3aR,4R,6R,6aR)-4-azido-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dibenzyl phosphate (PubChem CID 71530003) has the molecular formula C22H26N3O7P and a molecular weight of 475.44 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-azido-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dibenzyl phosphate.
| Compound Name | [(3aR,4R,6R,6aR)-4-azido-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dibenzyl phosphate |
|---|---|
| PubChem CID | 71530003 |
| Molecular Formula | C22H26N3O7P |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-azido-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl dibenzyl phosphate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](COP(=O)(OCc1ccccc1)OCc1ccccc1)O[C@H]2N=[N+]=[N-] |
| InChI | InChI=1S/C22H26N3O7P/c1-22(2)31-19-18(30-21(24-25-23)20(19)32-22)15-29-33(26,27-13-16-9-5-3-6-10-16)28-14-17-11-7-4-8-12-17/h3-12,18-21H,13-15H2,1-2H3/t18-,19-,20-,21-/m1/s1 |
| InChIKey | NCLLVYOMRMDOTQ-XRXFAXGQSA-N |
| XLogP | 5.10 |
| TPSA | 121.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|