C22H25O8P — CID 10961317
[(3aR,5R,6aS)-2,2-dimethyl-6-oxo-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-5-yl]methyl dibenzyl phosphate (PubChem CID 10961317) has the molecular formula C22H25O8P and a molecular weight of 448.41 g/mol. Its IUPAC name is [(3aR,5R,6aS)-2,2-dimethyl-6-oxo-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-5-yl]methyl dibenzyl phosphate.
| Compound Name | [(3aR,5R,6aS)-2,2-dimethyl-6-oxo-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-5-yl]methyl dibenzyl phosphate |
|---|---|
| PubChem CID | 10961317 |
| Molecular Formula | C22H25O8P |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | [(3aR,5R,6aS)-2,2-dimethyl-6-oxo-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-5-yl]methyl dibenzyl phosphate |
| SMILES | CC1(C)O[C@H]2O[C@H](COP(=O)(OCc3ccccc3)OCc3ccccc3)C(=O)[C@H]2O1 |
| InChI | InChI=1S/C22H25O8P/c1-22(2)29-20-19(23)18(28-21(20)30-22)15-27-31(24,25-13-16-9-5-3-6-10-16)26-14-17-11-7-4-8-12-17/h3-12,18,20-21H,13-15H2,1-2H3/t18-,20-,21-/m1/s1 |
| InChIKey | AXOVBHXXXHJPIA-HMXCVIKNSA-N |
| XLogP | 3.99 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|