C8H11O5P — CID 153301021
(3aR,5S,6aS)-2,2-dimethyl-5-(phosphorosomethyl)-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-one (PubChem CID 153301021) has the molecular formula C8H11O5P and a molecular weight of 218.14 g/mol. Its IUPAC name is (3aR,5S,6aS)-2,2-dimethyl-5-(phosphorosomethyl)-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-one.
| Compound Name | (3aR,5S,6aS)-2,2-dimethyl-5-(phosphorosomethyl)-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-one |
|---|---|
| PubChem CID | 153301021 |
| Molecular Formula | C8H11O5P |
| Molecular Weight | 218.14 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | (3aR,5S,6aS)-2,2-dimethyl-5-(phosphorosomethyl)-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-one |
| SMILES | CC1(C)O[C@H]2O[C@H](CP=O)C(=O)[C@H]2O1 |
| InChI | InChI=1S/C8H11O5P/c1-8(2)12-6-5(9)4(3-14-10)11-7(6)13-8/h4,6-7H,3H2,1-2H3/t4-,6-,7-/m1/s1 |
| InChIKey | GEGJNDKYBFTPTE-QPPQHZFASA-N |
| XLogP | 0.72 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.14 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|