C23H29O7P — CID 102353884
(3aR,5R,6R,6aR)-5-[2-bis(phenylmethoxy)phosphorylethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol (PubChem CID 102353884) has the molecular formula C23H29O7P and a molecular weight of 448.45 g/mol. Its IUPAC name is (3aR,5R,6R,6aR)-5-[2-bis(phenylmethoxy)phosphorylethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aR,5R,6R,6aR)-5-[2-bis(phenylmethoxy)phosphorylethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 102353884 |
| Molecular Formula | C23H29O7P |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (3aR,5R,6R,6aR)-5-[2-bis(phenylmethoxy)phosphorylethyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| SMILES | CC1(C)O[C@H]2O[C@H](CCP(=O)(OCc3ccccc3)OCc3ccccc3)[C@@H](O)[C@H]2O1 |
| InChI | InChI=1S/C23H29O7P/c1-23(2)29-21-20(24)19(28-22(21)30-23)13-14-31(25,26-15-17-9-5-3-6-10-17)27-16-18-11-7-4-8-12-18/h3-12,19-22,24H,13-16H2,1-2H3/t19-,20-,21-,22-/m1/s1 |
| InChIKey | KFAFFKSYRCDFNS-GXRSIYKFSA-N |
| XLogP | 4.24 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|