C26H28O4Sn — CID 177429410
(3aS,5R,6S,6aS)-2,2-dimethyl-5-(triphenylstannylmethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol (PubChem CID 177429410) has the molecular formula C26H28O4Sn and a molecular weight of 523.22 g/mol. Its IUPAC name is (3aS,5R,6S,6aS)-2,2-dimethyl-5-(triphenylstannylmethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aS,5R,6S,6aS)-2,2-dimethyl-5-(triphenylstannylmethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 177429410 |
| Molecular Formula | C26H28O4Sn |
| Molecular Weight | 523.22 g/mol |
| Exact Mass | 524.10 |
| IUPAC Name | (3aS,5R,6S,6aS)-2,2-dimethyl-5-(triphenylstannylmethyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| SMILES | CC1(C)O[C@@H]2O[C@@H](C[Sn](c3ccccc3)(c3ccccc3)c3ccccc3)[C@@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C8H13O4.3C6H5.Sn/c1-4-5(9)6-7(10-4)12-8(2,3)11-6;3*1-2-4-6-5-3-1;/h4-7,9H,1H2,2-3H3;3*1-5H;/t4-,5+,6-,7-;;;;/m0..../s1 |
| InChIKey | UTEYIUFCXIHMAR-JUTLAJSJSA-N |
| XLogP | 2.39 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.22 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |