C16H17NO6 — CID 58618393
2-[[(3aS,5R,6aS)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-deuteriomethyl]isoindole-1,3-dione (PubChem CID 58618393) has the molecular formula C16H17NO6 and a molecular weight of 320.32 g/mol. Its IUPAC name is 2-[[(3aS,5R,6aS)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-deuteriomethyl]isoindole-1,3-dione.
| Compound Name | 2-[[(3aS,5R,6aS)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-deuteriomethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58618393 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 2-[[(3aS,5R,6aS)-6-hydroxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-deuteriomethyl]isoindole-1,3-dione |
| SMILES | [2H]C([C@H]1O[C@H]2OC(C)(C)O[C@H]2C1O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H17NO6/c1-16(2)22-12-11(18)10(21-15(12)23-16)7-17-13(19)8-5-3-4-6-9(8)14(17)20/h3-6,10-12,15,18H,7H2,1-2H3/t10-,11?,12+,15+/m1/s1/i7D/t7?,10-,11?,12+,15+ |
| InChIKey | KOHGPJVJHMLGBN-JWINWPHVSA-N |
| XLogP | 0.52 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|