C20H23IO4Sn — CID 11731485
(3aS,5R,6S,6aS)-5-[[iodo(diphenyl)stannyl]methyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol (PubChem CID 11731485) has the molecular formula C20H23IO4Sn and a molecular weight of 573.02 g/mol. Its IUPAC name is (3aS,5R,6S,6aS)-5-[[iodo(diphenyl)stannyl]methyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol.
| Compound Name | (3aS,5R,6S,6aS)-5-[[iodo(diphenyl)stannyl]methyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
|---|---|
| PubChem CID | 11731485 |
| Molecular Formula | C20H23IO4Sn |
| Molecular Weight | 573.02 g/mol |
| Exact Mass | 573.97 |
| IUPAC Name | (3aS,5R,6S,6aS)-5-[[iodo(diphenyl)stannyl]methyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-ol |
| SMILES | CC1(C)O[C@@H]2O[C@@H](C[Sn](I)(c3ccccc3)c3ccccc3)[C@@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C8H13O4.2C6H5.HI.Sn/c1-4-5(9)6-7(10-4)12-8(2,3)11-6;2*1-2-4-6-5-3-1;;/h4-7,9H,1H2,2-3H3;2*1-5H;1H;/q;;;;+1/p-1/t4-,5+,6-,7-;;;;/m0..../s1 |
| InChIKey | UTWFGEWNRISWAP-JUTLAJSJSA-M |
| XLogP | 2.42 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.02 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|