C15H20O5 — CID 10564691
(3aS,5R,6S,7S,7aS)-5-(hydroxymethyl)-2,2-dimethyl-7-phenyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-ol (PubChem CID 10564691) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (3aS,5R,6S,7S,7aS)-5-(hydroxymethyl)-2,2-dimethyl-7-phenyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-ol.
| Compound Name | (3aS,5R,6S,7S,7aS)-5-(hydroxymethyl)-2,2-dimethyl-7-phenyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-ol |
|---|---|
| PubChem CID | 10564691 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (3aS,5R,6S,7S,7aS)-5-(hydroxymethyl)-2,2-dimethyl-7-phenyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6-ol |
| SMILES | CC1(C)O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](c3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C15H20O5/c1-15(2)19-13-11(9-6-4-3-5-7-9)12(17)10(8-16)18-14(13)20-15/h3-7,10-14,16-17H,8H2,1-2H3/t10-,11+,12-,13+,14+/m1/s1 |
| InChIKey | SLMKXVBSWRHHNT-BJJPWKGXSA-N |
| XLogP | 1.00 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |