C12H16O3 — CID 70795418
(2R,3R)-2-(hydroxymethyl)-5-methyl-4-phenyloxolan-3-ol (PubChem CID 70795418) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (2R,3R)-2-(hydroxymethyl)-5-methyl-4-phenyloxolan-3-ol.
| Compound Name | (2R,3R)-2-(hydroxymethyl)-5-methyl-4-phenyloxolan-3-ol |
|---|---|
| PubChem CID | 70795418 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (2R,3R)-2-(hydroxymethyl)-5-methyl-4-phenyloxolan-3-ol |
| SMILES | CC1O[C@H](CO)[C@H](O)C1c1ccccc1 |
| InChI | InChI=1S/C12H16O3/c1-8-11(9-5-3-2-4-6-9)12(14)10(7-13)15-8/h2-6,8,10-14H,7H2,1H3/t8?,10-,11?,12+/m1/s1 |
| InChIKey | FXYLOYXSRORQIR-VXJRZWNLSA-N |
| XLogP | 0.91 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |