C8H16O4 — CID 121426281
(3R,4R)-2-(hydroxymethyl)-5,6-dimethyloxane-3,4-diol (PubChem CID 121426281) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is (3R,4R)-2-(hydroxymethyl)-5,6-dimethyloxane-3,4-diol.
| Compound Name | (3R,4R)-2-(hydroxymethyl)-5,6-dimethyloxane-3,4-diol |
|---|---|
| PubChem CID | 121426281 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (3R,4R)-2-(hydroxymethyl)-5,6-dimethyloxane-3,4-diol |
| SMILES | CC1OC(CO)[C@H](O)[C@H](O)C1C |
| InChI | InChI=1S/C8H16O4/c1-4-5(2)12-6(3-9)8(11)7(4)10/h4-11H,3H2,1-2H3/t4?,5?,6?,7-,8+/m1/s1 |
| InChIKey | LTBQNATWEMHOJX-KVUYBKPXSA-N |
| XLogP | -0.88 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |