C10H22O4 — CID 144927729
ethane;2-(hydroxymethyl)-5,6-dimethyloxane-3,4-diol (PubChem CID 144927729) has the molecular formula C10H22O4 and a molecular weight of 206.28 g/mol. Its IUPAC name is ethane;2-(hydroxymethyl)-5,6-dimethyloxane-3,4-diol.
| Compound Name | ethane;2-(hydroxymethyl)-5,6-dimethyloxane-3,4-diol |
|---|---|
| PubChem CID | 144927729 |
| Molecular Formula | C10H22O4 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | ethane;2-(hydroxymethyl)-5,6-dimethyloxane-3,4-diol |
| SMILES | CC.CC1OC(CO)C(O)C(O)C1C |
| InChI | InChI=1S/C8H16O4.C2H6/c1-4-5(2)12-6(3-9)8(11)7(4)10;1-2/h4-11H,3H2,1-2H3;1-2H3 |
| InChIKey | YBUCJFQWUQAIIX-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |