C8H16O4 — CID 122527518
(2R,3S,4S,5S)-2-(hydroxymethyl)-5,6-dimethyloxane-3,4-diol (PubChem CID 122527518) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is (2R,3S,4S,5S)-2-(hydroxymethyl)-5,6-dimethyloxane-3,4-diol.
| Compound Name | (2R,3S,4S,5S)-2-(hydroxymethyl)-5,6-dimethyloxane-3,4-diol |
|---|---|
| PubChem CID | 122527518 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | (2R,3S,4S,5S)-2-(hydroxymethyl)-5,6-dimethyloxane-3,4-diol |
| SMILES | CC1O[C@H](CO)[C@@H](O)[C@@H](O)[C@@H]1C |
| InChI | InChI=1S/C8H16O4/c1-4-5(2)12-6(3-9)8(11)7(4)10/h4-11H,3H2,1-2H3/t4-,5?,6-,7+,8-/m1/s1 |
| InChIKey | LTBQNATWEMHOJX-RYXNKOGWSA-N |
| XLogP | -0.88 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |