C14H24N4O7 — CID 102182204
N-[(2S,3R,4aS,5R,7R,8R,8aR)-7-azido-5-(hydroxymethyl)-2,3-dimethoxy-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl]acetamide (PubChem CID 102182204) has the molecular formula C14H24N4O7 and a molecular weight of 360.37 g/mol. Its IUPAC name is N-[(2S,3R,4aS,5R,7R,8R,8aR)-7-azido-5-(hydroxymethyl)-2,3-dimethoxy-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl]acetamide.
| Compound Name | N-[(2S,3R,4aS,5R,7R,8R,8aR)-7-azido-5-(hydroxymethyl)-2,3-dimethoxy-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl]acetamide |
|---|---|
| PubChem CID | 102182204 |
| Molecular Formula | C14H24N4O7 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-[(2S,3R,4aS,5R,7R,8R,8aR)-7-azido-5-(hydroxymethyl)-2,3-dimethoxy-2,3-dimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxin-8-yl]acetamide |
| SMILES | CO[C@@]1(C)O[C@@H]2[C@@H](NC(C)=O)[C@H](N=[N+]=[N-])O[C@H](CO)[C@H]2O[C@@]1(C)OC |
| InChI | InChI=1S/C14H24N4O7/c1-7(20)16-9-11-10(8(6-19)23-12(9)17-18-15)24-13(2,21-4)14(3,22-5)25-11/h8-12,19H,6H2,1-5H3,(H,16,20)/t8-,9-,10-,11-,12-,13-,14+/m1/s1 |
| InChIKey | ISDMGEHOVFYYQD-UAZQNFISSA-N |
| XLogP | 0.03 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|