C10H18N6O4 — CID 59439595
(2R,3R,5R,6S)-5,6-bis(azidomethyl)-2,3-dimethoxy-2,3-dimethyl-1,4-dioxane (PubChem CID 59439595) has the molecular formula C10H18N6O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is (2R,3R,5R,6S)-5,6-bis(azidomethyl)-2,3-dimethoxy-2,3-dimethyl-1,4-dioxane.
| Compound Name | (2R,3R,5R,6S)-5,6-bis(azidomethyl)-2,3-dimethoxy-2,3-dimethyl-1,4-dioxane |
|---|---|
| PubChem CID | 59439595 |
| Molecular Formula | C10H18N6O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (2R,3R,5R,6S)-5,6-bis(azidomethyl)-2,3-dimethoxy-2,3-dimethyl-1,4-dioxane |
| SMILES | CO[C@]1(C)O[C@@H](CN=[N+]=[N-])[C@@H](CN=[N+]=[N-])O[C@@]1(C)OC |
| InChI | InChI=1S/C10H18N6O4/c1-9(17-3)10(2,18-4)20-8(6-14-16-12)7(19-9)5-13-15-11/h7-8H,5-6H2,1-4H3/t7-,8+,9-,10-/m1/s1 |
| InChIKey | VKZQUTPIKFBBMZ-UTINFBMNSA-N |
| XLogP | 2.12 |
| TPSA | 134.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|