C12H19N3O6 — CID 169302336
(5S)-5-[(4S)-5-(azidomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid (PubChem CID 169302336) has the molecular formula C12H19N3O6 and a molecular weight of 301.30 g/mol. Its IUPAC name is (5S)-5-[(4S)-5-(azidomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid.
| Compound Name | (5S)-5-[(4S)-5-(azidomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 169302336 |
| Molecular Formula | C12H19N3O6 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | (5S)-5-[(4S)-5-(azidomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
| SMILES | CC1(C)OC(C(=O)O)[C@H]([C@H]2OC(C)(C)OC2CN=[N+]=[N-])O1 |
| InChI | InChI=1S/C12H19N3O6/c1-11(2)18-6(5-14-15-13)7(19-11)8-9(10(16)17)21-12(3,4)20-8/h6-9H,5H2,1-4H3,(H,16,17)/t6?,7-,8-,9?/m0/s1 |
| InChIKey | NLRNBWHZBVCPCT-QXNPHUFVSA-N |
| XLogP | 1.42 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|