C27H27F5N4O7 — CID 71480058
(2,3,4,5,6-pentafluorophenyl) (2S)-2-[[(4R,5S)-5-[(4S,5R)-5-(azidomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carbonyl]amino]-3-phenylpropanoate (PubChem CID 71480058) has the molecular formula C27H27F5N4O7 and a molecular weight of 614.52 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (2S)-2-[[(4R,5S)-5-[(4S,5R)-5-(azidomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carbonyl]amino]-3-phenylpropanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (2S)-2-[[(4R,5S)-5-[(4S,5R)-5-(azidomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 71480058 |
| Molecular Formula | C27H27F5N4O7 |
| Molecular Weight | 614.52 g/mol |
| Exact Mass | 614.18 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (2S)-2-[[(4R,5S)-5-[(4S,5R)-5-(azidomethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolane-4-carbonyl]amino]-3-phenylpropanoate |
| SMILES | CC1(C)O[C@H]([C@@H]2OC(C)(C)O[C@H]2C(=O)N[C@@H](Cc2ccccc2)C(=O)Oc2c(F)c(F)c(F)c(F)c2F)[C@@H](CN=[N+]=[N-])O1 |
| InChI | InChI=1S/C27H27F5N4O7/c1-26(2)40-14(11-34-36-33)20(41-26)22-23(43-27(3,4)42-22)24(37)35-13(10-12-8-6-5-7-9-12)25(38)39-21-18(31)16(29)15(28)17(30)19(21)32/h5-9,13-14,20,22-23H,10-11H2,1-4H3,(H,35,37)/t13-,14+,20-,22-,23+/m0/s1 |
| InChIKey | RQSPGMKUJALMPN-AMSKZOHWSA-N |
| XLogP | 4.37 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|