C18H24N4O5 — CID 10571560
methyl 2-[[(3aR,5R,6S,6aR)-6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylamino]-3-phenylpropanoate (PubChem CID 10571560) has the molecular formula C18H24N4O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is methyl 2-[[(3aR,5R,6S,6aR)-6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylamino]-3-phenylpropanoate.
| Compound Name | methyl 2-[[(3aR,5R,6S,6aR)-6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 10571560 |
| Molecular Formula | C18H24N4O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | methyl 2-[[(3aR,5R,6S,6aR)-6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methylamino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C18H24N4O5/c1-18(2)26-15-14(21-22-19)13(25-17(15)27-18)10-20-12(16(23)24-3)9-11-7-5-4-6-8-11/h4-8,12-15,17,20H,9-10H2,1-3H3/t12?,13-,14+,15-,17-/m1/s1 |
| InChIKey | UKBIFBVNVMRKNH-MKFYTORXSA-N |
| XLogP | 1.92 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|