C17H30N3O8P — CID 24888973
[3-[(5R,6R,6aR)-6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-diethoxyphosphorylpropyl] propanoate (PubChem CID 24888973) has the molecular formula C17H30N3O8P and a molecular weight of 435.41 g/mol. Its IUPAC name is [3-[(5R,6R,6aR)-6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-diethoxyphosphorylpropyl] propanoate.
| Compound Name | [3-[(5R,6R,6aR)-6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-diethoxyphosphorylpropyl] propanoate |
|---|---|
| PubChem CID | 24888973 |
| Molecular Formula | C17H30N3O8P |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | [3-[(5R,6R,6aR)-6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-diethoxyphosphorylpropyl] propanoate |
| SMILES | CCOP(=O)(OCC)C(COC(=O)CC)C[C@H]1OC2OC(C)(C)O[C@@H]2[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C17H30N3O8P/c1-6-13(21)23-10-11(29(22,24-7-2)25-8-3)9-12-14(19-20-18)15-16(26-12)28-17(4,5)27-15/h11-12,14-16H,6-10H2,1-5H3/t11?,12-,14-,15-,16?/m1/s1 |
| InChIKey | RRAAOJRNAONYJL-VXURVKEPSA-N |
| XLogP | 3.52 |
| TPSA | 138.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|