C30H54N6O15P2 — CID 158067805
ethyl 3-(6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-diethoxyphosphorylpropanoate;ethyl 3-(3-azido-4-hydroxy-5-methyloxolan-2-yl)-2-diethoxyphosphorylpropanoate (PubChem CID 158067805) has the molecular formula C30H54N6O15P2 and a molecular weight of 800.74 g/mol. Its IUPAC name is ethyl 3-(6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-diethoxyphosphorylpropanoate;ethyl 3-(3-azido-4-hydroxy-5-methyloxolan-2-yl)-2-diethoxyphosphorylpropanoate.
| Compound Name | ethyl 3-(6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-diethoxyphosphorylpropanoate;ethyl 3-(3-azido-4-hydroxy-5-methyloxolan-2-yl)-2-diethoxyphosphorylpropanoate |
|---|---|
| PubChem CID | 158067805 |
| Molecular Formula | C30H54N6O15P2 |
| Molecular Weight | 800.74 g/mol |
| Exact Mass | 800.31 |
| IUPAC Name | ethyl 3-(6-azido-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-diethoxyphosphorylpropanoate;ethyl 3-(3-azido-4-hydroxy-5-methyloxolan-2-yl)-2-diethoxyphosphorylpropanoate |
| SMILES | CCOC(=O)C(CC1OC(C)C(O)C1N=[N+]=[N-])P(=O)(OCC)OCC.CCOC(=O)C(CC1OC2OC(C)(C)OC2C1N=[N+]=[N-])P(=O)(OCC)OCC |
| InChI | InChI=1S/C16H28N3O8P.C14H26N3O7P/c1-6-22-14(20)11(28(21,23-7-2)24-8-3)9-10-12(18-19-17)13-15(25-10)27-16(4,5)26-13;1-5-21-14(19)11(25(20,22-6-2)23-7-3)8-10-12(16-17-15)13(18)9(4)24-10/h10-13,15H,6-9H2,1-5H3;9-13,18H,5-8H2,1-4H3 |
| InChIKey | FLLILRLCBRUQFG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 278.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.74 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|