C22H26N6O3 — CID 139822213
benzyl N-[(2S)-1-[[(3S,5S)-5-(azidomethyl)pyrrolidin-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 139822213) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(3S,5S)-5-(azidomethyl)pyrrolidin-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(3S,5S)-5-(azidomethyl)pyrrolidin-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 139822213 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | benzyl N-[(2S)-1-[[(3S,5S)-5-(azidomethyl)pyrrolidin-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | [N-]=[N+]=NC[C@@H]1C[C@H](NC(=O)[C@H](Cc2ccccc2)NC(=O)OCc2ccccc2)CN1 |
| InChI | InChI=1S/C22H26N6O3/c23-28-25-14-18-12-19(13-24-18)26-21(29)20(11-16-7-3-1-4-8-16)27-22(30)31-15-17-9-5-2-6-10-17/h1-10,18-20,24H,11-15H2,(H,26,29)(H,27,30)/t18-,19-,20-/m0/s1 |
| InChIKey | MYWZRAFFPXNPML-UFYCRDLUSA-N |
| XLogP | 2.68 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|