C33H32N6O4 — CID 139822145
benzyl N-[(2S)-1-[[(3S,5S)-5-(azidomethyl)-1-(naphthalene-2-carbonyl)pyrrolidin-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 139822145) has the molecular formula C33H32N6O4 and a molecular weight of 576.66 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[[(3S,5S)-5-(azidomethyl)-1-(naphthalene-2-carbonyl)pyrrolidin-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[[(3S,5S)-5-(azidomethyl)-1-(naphthalene-2-carbonyl)pyrrolidin-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 139822145 |
| Molecular Formula | C33H32N6O4 |
| Molecular Weight | 576.66 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | benzyl N-[(2S)-1-[[(3S,5S)-5-(azidomethyl)-1-(naphthalene-2-carbonyl)pyrrolidin-3-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | [N-]=[N+]=NC[C@@H]1C[C@H](NC(=O)[C@H](Cc2ccccc2)NC(=O)OCc2ccccc2)CN1C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C33H32N6O4/c34-38-35-20-29-19-28(21-39(29)32(41)27-16-15-25-13-7-8-14-26(25)18-27)36-31(40)30(17-23-9-3-1-4-10-23)37-33(42)43-22-24-11-5-2-6-12-24/h1-16,18,28-30H,17,19-22H2,(H,36,40)(H,37,42)/t28-,29-,30-/m0/s1 |
| InChIKey | WCYXPLNYFIGHDN-DTXPUJKBSA-N |
| XLogP | 5.39 |
| TPSA | 136.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.66 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|