C21H22N6O4S — CID 123264296
1-[(2R,3R,4R,5S,6S)-5-azido-2-(azidomethyl)-4-benzyl-3,4-dihydroxy-6-phenylsulfanyloxan-3-yl]ethanone (PubChem CID 123264296) has the molecular formula C21H22N6O4S and a molecular weight of 454.51 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5S,6S)-5-azido-2-(azidomethyl)-4-benzyl-3,4-dihydroxy-6-phenylsulfanyloxan-3-yl]ethanone.
| Compound Name | 1-[(2R,3R,4R,5S,6S)-5-azido-2-(azidomethyl)-4-benzyl-3,4-dihydroxy-6-phenylsulfanyloxan-3-yl]ethanone |
|---|---|
| PubChem CID | 123264296 |
| Molecular Formula | C21H22N6O4S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 1-[(2R,3R,4R,5S,6S)-5-azido-2-(azidomethyl)-4-benzyl-3,4-dihydroxy-6-phenylsulfanyloxan-3-yl]ethanone |
| SMILES | CC(=O)[C@@]1(O)[C@@H](CN=[N+]=[N-])O[C@@H](Sc2ccccc2)[C@@H](N=[N+]=[N-])[C@]1(O)Cc1ccccc1 |
| InChI | InChI=1S/C21H22N6O4S/c1-14(28)21(30)17(13-24-26-22)31-19(32-16-10-6-3-7-11-16)18(25-27-23)20(21,29)12-15-8-4-2-5-9-15/h2-11,17-19,29-30H,12-13H2,1H3/t17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | AXZHVQJSGAWGAE-YMQHIKHWSA-N |
| XLogP | 3.79 |
| TPSA | 164.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|