C19H24O9 — CID 90459790
1-[(2R,3R,4R,5S,6S)-3,4-diacetyl-5-benzyl-3,4,5,6-tetrahydroxyoxan-2-yl]-1-hydroxypropan-2-one (PubChem CID 90459790) has the molecular formula C19H24O9 and a molecular weight of 396.39 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5S,6S)-3,4-diacetyl-5-benzyl-3,4,5,6-tetrahydroxyoxan-2-yl]-1-hydroxypropan-2-one.
| Compound Name | 1-[(2R,3R,4R,5S,6S)-3,4-diacetyl-5-benzyl-3,4,5,6-tetrahydroxyoxan-2-yl]-1-hydroxypropan-2-one |
|---|---|
| PubChem CID | 90459790 |
| Molecular Formula | C19H24O9 |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 1-[(2R,3R,4R,5S,6S)-3,4-diacetyl-5-benzyl-3,4,5,6-tetrahydroxyoxan-2-yl]-1-hydroxypropan-2-one |
| SMILES | CC(=O)C(O)[C@H]1O[C@H](O)[C@](O)(Cc2ccccc2)[C@](O)(C(C)=O)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C19H24O9/c1-10(20)14(23)15-18(26,11(2)21)19(27,12(3)22)17(25,16(24)28-15)9-13-7-5-4-6-8-13/h4-8,14-16,23-27H,9H2,1-3H3/t14?,15-,16+,17-,18-,19-/m1/s1 |
| InChIKey | SQONDYAHYZJHAQ-HHNIUTBGSA-N |
| XLogP | -1.73 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |