C28H36O8 — CID 175801072
1-[(2R,3S,4S,5R,6S)-6-deuterio-5,6-dihydroxy-3,4-bis(phenylmethoxy)-5-propan-2-yloxan-2-yl]-1-hydroxyhexane-2,5-dione (PubChem CID 175801072) has the molecular formula C28H36O8 and a molecular weight of 501.59 g/mol. Its IUPAC name is 1-[(2R,3S,4S,5R,6S)-6-deuterio-5,6-dihydroxy-3,4-bis(phenylmethoxy)-5-propan-2-yloxan-2-yl]-1-hydroxyhexane-2,5-dione.
| Compound Name | 1-[(2R,3S,4S,5R,6S)-6-deuterio-5,6-dihydroxy-3,4-bis(phenylmethoxy)-5-propan-2-yloxan-2-yl]-1-hydroxyhexane-2,5-dione |
|---|---|
| PubChem CID | 175801072 |
| Molecular Formula | C28H36O8 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | 1-[(2R,3S,4S,5R,6S)-6-deuterio-5,6-dihydroxy-3,4-bis(phenylmethoxy)-5-propan-2-yloxan-2-yl]-1-hydroxyhexane-2,5-dione |
| SMILES | [2H][C@]1(O)O[C@H](C(O)C(=O)CCC(C)=O)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@]1(O)C(C)C |
| InChI | InChI=1S/C28H36O8/c1-18(2)28(33)26(35-17-21-12-8-5-9-13-21)25(34-16-20-10-6-4-7-11-20)24(36-27(28)32)23(31)22(30)15-14-19(3)29/h4-13,18,23-27,31-33H,14-17H2,1-3H3/t23?,24-,25+,26+,27+,28-/m1/s1/i27D |
| InChIKey | KMDWCJDCPDLOTM-AALSFIJQSA-N |
| XLogP | 2.56 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |