C27H32O11 — CID 18457734
dibenzyl 2-[4-hydroxy-3-oxo-4-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]butyl]propanedioate (PubChem CID 18457734) has the molecular formula C27H32O11 and a molecular weight of 532.54 g/mol. Its IUPAC name is dibenzyl 2-[4-hydroxy-3-oxo-4-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]butyl]propanedioate.
| Compound Name | dibenzyl 2-[4-hydroxy-3-oxo-4-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]butyl]propanedioate |
|---|---|
| PubChem CID | 18457734 |
| Molecular Formula | C27H32O11 |
| Molecular Weight | 532.54 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | dibenzyl 2-[4-hydroxy-3-oxo-4-[(2S,3S,4S,5S,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]butyl]propanedioate |
| SMILES | CO[C@H]1O[C@H](C(O)C(=O)CCC(C(=O)OCc2ccccc2)C(=O)OCc2ccccc2)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H32O11/c1-35-27-23(32)21(30)22(31)24(38-27)20(29)19(28)13-12-18(25(33)36-14-16-8-4-2-5-9-16)26(34)37-15-17-10-6-3-7-11-17/h2-11,18,20-24,27,29-32H,12-15H2,1H3/t20?,21-,22-,23-,24+,27-/m0/s1 |
| InChIKey | WIIWIHMTGOLKTL-KTBQDTAFSA-N |
| XLogP | 0.25 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.54 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|