C15H20O7 — CID 122403648
benzyl (2S,3S,4R,5R,6S)-4,5-dihydroxy-3,6-dimethoxyoxane-2-carboxylate (PubChem CID 122403648) has the molecular formula C15H20O7 and a molecular weight of 312.32 g/mol. Its IUPAC name is benzyl (2S,3S,4R,5R,6S)-4,5-dihydroxy-3,6-dimethoxyoxane-2-carboxylate.
| Compound Name | benzyl (2S,3S,4R,5R,6S)-4,5-dihydroxy-3,6-dimethoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 122403648 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | benzyl (2S,3S,4R,5R,6S)-4,5-dihydroxy-3,6-dimethoxyoxane-2-carboxylate |
| SMILES | CO[C@H]1O[C@H](C(=O)OCc2ccccc2)[C@@H](OC)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H20O7/c1-19-12-10(16)11(17)15(20-2)22-13(12)14(18)21-8-9-6-4-3-5-7-9/h3-7,10-13,15-17H,8H2,1-2H3/t10-,11-,12+,13+,15+/m1/s1 |
| InChIKey | TYXJSKXYACBLDN-BIGJJFBESA-N |
| XLogP | -0.16 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |