C24H26O10 — CID 169444328
1-O-propyl 2-O-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-phenylmethoxycarbonyloxan-2-yl] benzene-1,2-dicarboxylate (PubChem CID 169444328) has the molecular formula C24H26O10 and a molecular weight of 474.46 g/mol. Its IUPAC name is 1-O-propyl 2-O-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-phenylmethoxycarbonyloxan-2-yl] benzene-1,2-dicarboxylate.
| Compound Name | 1-O-propyl 2-O-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-phenylmethoxycarbonyloxan-2-yl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 169444328 |
| Molecular Formula | C24H26O10 |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 1-O-propyl 2-O-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-phenylmethoxycarbonyloxan-2-yl] benzene-1,2-dicarboxylate |
| SMILES | CCCOC(=O)c1ccccc1C(=O)O[C@@H]1O[C@H](C(=O)OCc2ccccc2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H26O10/c1-2-12-31-21(28)15-10-6-7-11-16(15)22(29)34-24-19(27)17(25)18(26)20(33-24)23(30)32-13-14-8-4-3-5-9-14/h3-11,17-20,24-27H,2,12-13H2,1H3/t17-,18-,19+,20-,24-/m0/s1 |
| InChIKey | HRBXDQWRRLGSIT-QTQLYOFPSA-N |
| XLogP | 0.96 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|