C16H20O8 — CID 22885257
phenacyl (2S,3S,4S,5R)-6-ethoxy-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 22885257) has the molecular formula C16H20O8 and a molecular weight of 340.33 g/mol. Its IUPAC name is phenacyl (2S,3S,4S,5R)-6-ethoxy-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | phenacyl (2S,3S,4S,5R)-6-ethoxy-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 22885257 |
| Molecular Formula | C16H20O8 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | phenacyl (2S,3S,4S,5R)-6-ethoxy-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | CCOC1O[C@H](C(=O)OCC(=O)c2ccccc2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H20O8/c1-2-22-16-13(20)11(18)12(19)14(24-16)15(21)23-8-10(17)9-6-4-3-5-7-9/h3-7,11-14,16,18-20H,2,8H2,1H3/t11-,12-,13+,14-,16?/m0/s1 |
| InChIKey | NBBKTFYLTKENEA-AKFOCJAPSA-N |
| XLogP | -0.74 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |