C16H18O9 — CID 131837512
6-[(Z)-2-carboxy-3-phenylprop-2-enoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 131837512) has the molecular formula C16H18O9 and a molecular weight of 354.31 g/mol. Its IUPAC name is 6-[(Z)-2-carboxy-3-phenylprop-2-enoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[(Z)-2-carboxy-3-phenylprop-2-enoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 131837512 |
| Molecular Formula | C16H18O9 |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 6-[(Z)-2-carboxy-3-phenylprop-2-enoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)/C(=C\c1ccccc1)COC1OC(C(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C16H18O9/c17-10-11(18)13(15(22)23)25-16(12(10)19)24-7-9(14(20)21)6-8-4-2-1-3-5-8/h1-6,10-13,16-19H,7H2,(H,20,21)(H,22,23)/b9-6- |
| InChIKey | OROMYRHSNXJELX-TWGQIWQCSA-N |
| XLogP | -0.94 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|