C15H18O8 — CID 131838912
3,4,5-trihydroxy-6-[(3-phenyloxiran-2-yl)methoxy]oxane-2-carboxylic acid (PubChem CID 131838912) has the molecular formula C15H18O8 and a molecular weight of 326.30 g/mol. Its IUPAC name is 3,4,5-trihydroxy-6-[(3-phenyloxiran-2-yl)methoxy]oxane-2-carboxylic acid.
| Compound Name | 3,4,5-trihydroxy-6-[(3-phenyloxiran-2-yl)methoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 131838912 |
| Molecular Formula | C15H18O8 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 3,4,5-trihydroxy-6-[(3-phenyloxiran-2-yl)methoxy]oxane-2-carboxylic acid |
| SMILES | O=C(O)C1OC(OCC2OC2c2ccccc2)C(O)C(O)C1O |
| InChI | InChI=1S/C15H18O8/c16-9-10(17)13(14(19)20)23-15(11(9)18)21-6-8-12(22-8)7-4-2-1-3-5-7/h1-5,8-13,15-18H,6H2,(H,19,20) |
| InChIKey | GOMSMXROJXSLEY-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|