C13H14O9 — CID 15768273
6-(2-carboxyphenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 15768273) has the molecular formula C13H14O9 and a molecular weight of 314.25 g/mol. Its IUPAC name is 6-(2-carboxyphenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-(2-carboxyphenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 15768273 |
| Molecular Formula | C13H14O9 |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 6-(2-carboxyphenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)c1ccccc1OC1OC(C(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C13H14O9/c14-7-8(15)10(12(19)20)22-13(9(7)16)21-6-4-2-1-3-5(6)11(17)18/h1-4,7-10,13-16H,(H,17,18)(H,19,20) |
| InChIKey | JSCWDKKMLIQCMR-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |