C12H13Cl2NO7 — CID 87206984
(2S,3S,4S,5R,6S)-6-[2-(dichloroamino)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 87206984) has the molecular formula C12H13Cl2NO7 and a molecular weight of 354.14 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-6-[2-(dichloroamino)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-6-[2-(dichloroamino)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 87206984 |
| Molecular Formula | C12H13Cl2NO7 |
| Molecular Weight | 354.14 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-[2-(dichloroamino)phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1O[C@@H](Oc2ccccc2N(Cl)Cl)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H13Cl2NO7/c13-15(14)5-3-1-2-4-6(5)21-12-9(18)7(16)8(17)10(22-12)11(19)20/h1-4,7-10,12,16-18H,(H,19,20)/t7-,8-,9+,10-,12+/m0/s1 |
| InChIKey | CRXUUPSALZDITK-GOVZDWNOSA-N |
| XLogP | 0.07 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.14 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|