C12H13IO7 — CID 162942033
3,4,5-trihydroxy-6-(2-iodophenoxy)oxane-2-carboxylic acid (PubChem CID 162942033) has the molecular formula C12H13IO7 and a molecular weight of 396.13 g/mol. Its IUPAC name is 3,4,5-trihydroxy-6-(2-iodophenoxy)oxane-2-carboxylic acid.
| Compound Name | 3,4,5-trihydroxy-6-(2-iodophenoxy)oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 162942033 |
| Molecular Formula | C12H13IO7 |
| Molecular Weight | 396.13 g/mol |
| Exact Mass | 395.97 |
| IUPAC Name | 3,4,5-trihydroxy-6-(2-iodophenoxy)oxane-2-carboxylic acid |
| SMILES | O=C(O)C1OC(Oc2ccccc2I)C(O)C(O)C1O |
| InChI | InChI=1S/C12H13IO7/c13-5-3-1-2-4-6(5)19-12-9(16)7(14)8(15)10(20-12)11(17)18/h1-4,7-10,12,14-16H,(H,17,18) |
| InChIKey | NAPDMPILLUFMQR-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.13 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|