C31H32O12 — CID 10930036
benzyl [(2R,3R,4S,5S,6S)-3-hydroxy-6-methoxy-4,5-bis(phenylmethoxycarbonyloxy)oxan-2-yl]methyl carbonate (PubChem CID 10930036) has the molecular formula C31H32O12 and a molecular weight of 596.59 g/mol. Its IUPAC name is benzyl [(2R,3R,4S,5S,6S)-3-hydroxy-6-methoxy-4,5-bis(phenylmethoxycarbonyloxy)oxan-2-yl]methyl carbonate.
| Compound Name | benzyl [(2R,3R,4S,5S,6S)-3-hydroxy-6-methoxy-4,5-bis(phenylmethoxycarbonyloxy)oxan-2-yl]methyl carbonate |
|---|---|
| PubChem CID | 10930036 |
| Molecular Formula | C31H32O12 |
| Molecular Weight | 596.59 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | benzyl [(2R,3R,4S,5S,6S)-3-hydroxy-6-methoxy-4,5-bis(phenylmethoxycarbonyloxy)oxan-2-yl]methyl carbonate |
| SMILES | CO[C@H]1O[C@H](COC(=O)OCc2ccccc2)[C@@H](O)[C@H](OC(=O)OCc2ccccc2)[C@@H]1OC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H32O12/c1-36-28-27(43-31(35)39-19-23-15-9-4-10-16-23)26(42-30(34)38-18-22-13-7-3-8-14-22)25(32)24(41-28)20-40-29(33)37-17-21-11-5-2-6-12-21/h2-16,24-28,32H,17-20H2,1H3/t24-,25-,26+,27+,28+/m1/s1 |
| InChIKey | QCSQBVBCECKTPQ-MASCHLQQSA-N |
| XLogP | 4.52 |
| TPSA | 145.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|