C25H32O10S — CID 102424124
[(2R,3R,4S,5R,6S)-3-hydroxy-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl 2-methylsulfonylethyl carbonate (PubChem CID 102424124) has the molecular formula C25H32O10S and a molecular weight of 524.59 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3-hydroxy-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl 2-methylsulfonylethyl carbonate.
| Compound Name | [(2R,3R,4S,5R,6S)-3-hydroxy-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl 2-methylsulfonylethyl carbonate |
|---|---|
| PubChem CID | 102424124 |
| Molecular Formula | C25H32O10S |
| Molecular Weight | 524.59 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3-hydroxy-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]methyl 2-methylsulfonylethyl carbonate |
| SMILES | CO[C@H]1O[C@H](COC(=O)OCCS(C)(=O)=O)[C@@H](O)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C25H32O10S/c1-30-24-23(33-16-19-11-7-4-8-12-19)22(32-15-18-9-5-3-6-10-18)21(26)20(35-24)17-34-25(27)31-13-14-36(2,28)29/h3-12,20-24,26H,13-17H2,1-2H3/t20-,21-,22+,23-,24+/m1/s1 |
| InChIKey | LYWJGSSRRGHSQK-SJSRKZJXSA-N |
| XLogP | 2.09 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.59 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |