C36H38O8S — CID 164685539
2-[[(E)-2-(benzenesulfonyl)-3-phenylprop-1-enoxy]methyl]-6-methoxy-4,5-bis(phenylmethoxy)oxan-3-ol (PubChem CID 164685539) has the molecular formula C36H38O8S and a molecular weight of 630.76 g/mol. Its IUPAC name is 2-[[(E)-2-(benzenesulfonyl)-3-phenylprop-1-enoxy]methyl]-6-methoxy-4,5-bis(phenylmethoxy)oxan-3-ol.
| Compound Name | 2-[[(E)-2-(benzenesulfonyl)-3-phenylprop-1-enoxy]methyl]-6-methoxy-4,5-bis(phenylmethoxy)oxan-3-ol |
|---|---|
| PubChem CID | 164685539 |
| Molecular Formula | C36H38O8S |
| Molecular Weight | 630.76 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | 2-[[(E)-2-(benzenesulfonyl)-3-phenylprop-1-enoxy]methyl]-6-methoxy-4,5-bis(phenylmethoxy)oxan-3-ol |
| SMILES | COC1OC(CO/C=C(\Cc2ccccc2)S(=O)(=O)c2ccccc2)C(O)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C36H38O8S/c1-40-36-35(43-24-29-18-10-4-11-19-29)34(42-23-28-16-8-3-9-17-28)33(37)32(44-36)26-41-25-31(22-27-14-6-2-7-15-27)45(38,39)30-20-12-5-13-21-30/h2-21,25,32-37H,22-24,26H2,1H3/b31-25+ |
| InChIKey | YBGYCUHNCNJSMI-QCKNELIISA-N |
| XLogP | 5.46 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.76 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|