C29H32O7S2 — CID 102185528
(2S,3S,4S,5R,6R)-2-[[(Z)-2-(benzenesulfonyl)ethenyl]sulfanylmethyl]-6-methoxy-4,5-bis(phenylmethoxy)oxan-3-ol (PubChem CID 102185528) has the molecular formula C29H32O7S2 and a molecular weight of 556.70 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-2-[[(Z)-2-(benzenesulfonyl)ethenyl]sulfanylmethyl]-6-methoxy-4,5-bis(phenylmethoxy)oxan-3-ol.
| Compound Name | (2S,3S,4S,5R,6R)-2-[[(Z)-2-(benzenesulfonyl)ethenyl]sulfanylmethyl]-6-methoxy-4,5-bis(phenylmethoxy)oxan-3-ol |
|---|---|
| PubChem CID | 102185528 |
| Molecular Formula | C29H32O7S2 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | (2S,3S,4S,5R,6R)-2-[[(Z)-2-(benzenesulfonyl)ethenyl]sulfanylmethyl]-6-methoxy-4,5-bis(phenylmethoxy)oxan-3-ol |
| SMILES | CO[C@@H]1O[C@H](CS/C=C\S(=O)(=O)c2ccccc2)[C@@H](O)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C29H32O7S2/c1-33-29-28(35-20-23-13-7-3-8-14-23)27(34-19-22-11-5-2-6-12-22)26(30)25(36-29)21-37-17-18-38(31,32)24-15-9-4-10-16-24/h2-18,25-30H,19-21H2,1H3/b18-17-/t25-,26-,27+,28-,29-/m1/s1 |
| InChIKey | QEDHYLKRMVLMJC-MPAOKQKRSA-N |
| XLogP | 4.57 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |