C32H40O10S — CID 10930146
[(2S)-3-[(2R,3R,4S,5R,6S)-3-hydroxy-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]-2-(methoxymethoxy)propyl] 4-methylbenzenesulfonate (PubChem CID 10930146) has the molecular formula C32H40O10S and a molecular weight of 616.73 g/mol. Its IUPAC name is [(2S)-3-[(2R,3R,4S,5R,6S)-3-hydroxy-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]-2-(methoxymethoxy)propyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S)-3-[(2R,3R,4S,5R,6S)-3-hydroxy-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]-2-(methoxymethoxy)propyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10930146 |
| Molecular Formula | C32H40O10S |
| Molecular Weight | 616.73 g/mol |
| Exact Mass | 616.23 |
| IUPAC Name | [(2S)-3-[(2R,3R,4S,5R,6S)-3-hydroxy-6-methoxy-4,5-bis(phenylmethoxy)oxan-2-yl]-2-(methoxymethoxy)propyl] 4-methylbenzenesulfonate |
| SMILES | COCO[C@H](COS(=O)(=O)c1ccc(C)cc1)C[C@H]1O[C@H](OC)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C32H40O10S/c1-23-14-16-27(17-15-23)43(34,35)41-21-26(40-22-36-2)18-28-29(33)30(38-19-24-10-6-4-7-11-24)31(32(37-3)42-28)39-20-25-12-8-5-9-13-25/h4-17,26,28-33H,18-22H2,1-3H3/t26-,28+,29+,30-,31+,32-/m0/s1 |
| InChIKey | AFGDRYSJGBGOEA-SRTFTMACSA-N |
| XLogP | 3.98 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.73 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|